C31H28F3N7O6S2 — CID 24900071
N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]phenyl]sulfonyl-4-(trifluoromethoxy)benzamide (PubChem CID 24900071) has the molecular formula C31H28F3N7O6S2 and a molecular weight of 715.74 g/mol. Its IUPAC name is N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]phenyl]sulfonyl-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]phenyl]sulfonyl-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 24900071 |
| Molecular Formula | C31H28F3N7O6S2 |
| Molecular Weight | 715.74 g/mol |
| Exact Mass | 715.15 |
| IUPAC Name | N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]phenyl]sulfonyl-4-(trifluoromethoxy)benzamide |
| SMILES | COc1cc2[nH]c3ncnc(N4CCN(C(=S)Nc5ccc(S(=O)(=O)NC(=O)c6ccc(OC(F)(F)F)cc6)cc5)CC4)c3c2cc1OC |
| InChI | InChI=1S/C31H28F3N7O6S2/c1-45-24-15-22-23(16-25(24)46-2)38-27-26(22)28(36-17-35-27)40-11-13-41(14-12-40)30(48)37-19-5-9-21(10-6-19)49(43,44)39-29(42)18-3-7-20(8-4-18)47-31(32,33)34/h3-10,15-17H,11-14H2,1-2H3,(H,37,48)(H,39,42)(H,35,36,38) |
| InChIKey | MFWSBPRBRHUOET-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 151.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.74 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|