About N-benzhydryl-4,5-dimethoxy-2-methylaniline
N-benzhydryl-4,5-dimethoxy-2-methylaniline (PubChem CID 2490040) has the molecular formula C22H23NO2
and a molecular weight of 333.43 g/mol. Its IUPAC name is N-benzhydryl-4,5-dimethoxy-2-methylaniline.
Molecular Properties
| Compound Name | N-benzhydryl-4,5-dimethoxy-2-methylaniline |
| PubChem CID | 2490040 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N-benzhydryl-4,5-dimethoxy-2-methylaniline |
| SMILES | COc1cc(C)c(NC(c2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C22H23NO2/c1-16-14-20(24-2)21(25-3)15-19(16)23-22(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-15,22-23H,1-3H3 |
| InChIKey | SXZNXJOSCLEHKP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-benzhydryl-4,5-dimethoxy-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzhydryl-4,5-dimethoxy-2-methylaniline?
The IUPAC name of N-benzhydryl-4,5-dimethoxy-2-methylaniline (CID 2490040) is N-benzhydryl-4,5-dimethoxy-2-methylaniline.
What is the SMILES notation for N-benzhydryl-4,5-dimethoxy-2-methylaniline?
The canonical SMILES for N-benzhydryl-4,5-dimethoxy-2-methylaniline is COc1cc(C)c(NC(c2ccccc2)c2ccccc2)cc1OC.
What is the InChIKey of N-benzhydryl-4,5-dimethoxy-2-methylaniline?
The InChIKey is SXZNXJOSCLEHKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO2/c1-16-14-20(24-2)21(25-3)15-19(16)23-22(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-15,22-23H,1-3H3.
What are the key properties of N-benzhydryl-4,5-dimethoxy-2-methylaniline?
N-benzhydryl-4,5-dimethoxy-2-methylaniline has a molecular weight of 333.43 g/mol, XLogP of 5.21, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzhydryl-4,5-dimethoxy-2-methylaniline is sourced from PubChem (CID 2490040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).