C27H31N5O3 — CID 24900509
N-hydroxy-7-[4-[4-[[(1R)-1-phenylethyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]heptanamide (PubChem CID 24900509) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is N-hydroxy-7-[4-[4-[[(1R)-1-phenylethyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]heptanamide.
| Compound Name | N-hydroxy-7-[4-[4-[[(1R)-1-phenylethyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]heptanamide |
|---|---|
| PubChem CID | 24900509 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | N-hydroxy-7-[4-[4-[[(1R)-1-phenylethyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]heptanamide |
| SMILES | C[C@@H](Nc1ncnc2[nH]c(-c3ccc(OCCCCCCC(=O)NO)cc3)cc12)c1ccccc1 |
| InChI | InChI=1S/C27H31N5O3/c1-19(20-9-5-4-6-10-20)30-26-23-17-24(31-27(23)29-18-28-26)21-12-14-22(15-13-21)35-16-8-3-2-7-11-25(33)32-34/h4-6,9-10,12-15,17-19,34H,2-3,7-8,11,16H2,1H3,(H,32,33)(H2,28,29,30,31)/t19-/m1/s1 |
| InChIKey | FGGNCTXMNLDXQX-LJQANCHMSA-N |
| XLogP | 5.63 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|