C31H30N6O2 — CID 24900835
(E)-N-hydroxy-3-[4-[[[4-[4-[[(1R)-1-phenylethyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methylamino]methyl]phenyl]prop-2-enamide (PubChem CID 24900835) has the molecular formula C31H30N6O2 and a molecular weight of 518.62 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[4-[[[4-[4-[[(1R)-1-phenylethyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methylamino]methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[4-[[[4-[4-[[(1R)-1-phenylethyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methylamino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24900835 |
| Molecular Formula | C31H30N6O2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | (E)-N-hydroxy-3-[4-[[[4-[4-[[(1R)-1-phenylethyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methylamino]methyl]phenyl]prop-2-enamide |
| SMILES | C[C@@H](Nc1ncnc2[nH]c(-c3ccc(CNCc4ccc(/C=C/C(=O)NO)cc4)cc3)cc12)c1ccccc1 |
| InChI | InChI=1S/C31H30N6O2/c1-21(25-5-3-2-4-6-25)35-30-27-17-28(36-31(27)34-20-33-30)26-14-11-24(12-15-26)19-32-18-23-9-7-22(8-10-23)13-16-29(38)37-39/h2-17,20-21,32,39H,18-19H2,1H3,(H,37,38)(H2,33,34,35,36)/b16-13+/t21-/m1/s1 |
| InChIKey | PAHIRCOTELPEBD-RDOKFVIMSA-N |
| XLogP | 5.61 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|