C31H39N7O3 — CID 24900963
N-[2-[[7-(hydroxyamino)-7-oxoheptyl]amino]ethyl]-4-[7-methyl-4-[[(1R)-1-phenylethyl]amino]pyrrolo[2,3-d]pyrimidin-6-yl]benzamide (PubChem CID 24900963) has the molecular formula C31H39N7O3 and a molecular weight of 557.70 g/mol. Its IUPAC name is N-[2-[[7-(hydroxyamino)-7-oxoheptyl]amino]ethyl]-4-[7-methyl-4-[[(1R)-1-phenylethyl]amino]pyrrolo[2,3-d]pyrimidin-6-yl]benzamide.
| Compound Name | N-[2-[[7-(hydroxyamino)-7-oxoheptyl]amino]ethyl]-4-[7-methyl-4-[[(1R)-1-phenylethyl]amino]pyrrolo[2,3-d]pyrimidin-6-yl]benzamide |
|---|---|
| PubChem CID | 24900963 |
| Molecular Formula | C31H39N7O3 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.31 |
| IUPAC Name | N-[2-[[7-(hydroxyamino)-7-oxoheptyl]amino]ethyl]-4-[7-methyl-4-[[(1R)-1-phenylethyl]amino]pyrrolo[2,3-d]pyrimidin-6-yl]benzamide |
| SMILES | C[C@@H](Nc1ncnc2c1cc(-c1ccc(C(=O)NCCNCCCCCCC(=O)NO)cc1)n2C)c1ccccc1 |
| InChI | InChI=1S/C31H39N7O3/c1-22(23-10-6-5-7-11-23)36-29-26-20-27(38(2)30(26)35-21-34-29)24-13-15-25(16-14-24)31(40)33-19-18-32-17-9-4-3-8-12-28(39)37-41/h5-7,10-11,13-16,20-22,32,41H,3-4,8-9,12,17-19H2,1-2H3,(H,33,40)(H,37,39)(H,34,35,36)/t22-/m1/s1 |
| InChIKey | BVGMTOOWGPWDSU-JOCHJYFZSA-N |
| XLogP | 4.58 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|