C29H37N7O2 — CID 24901022
6-[6-[4-[(2-aminoethylamino)methyl]phenyl]-4-[[(1R)-1-phenylethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-N-hydroxyhexanamide (PubChem CID 24901022) has the molecular formula C29H37N7O2 and a molecular weight of 515.66 g/mol. Its IUPAC name is 6-[6-[4-[(2-aminoethylamino)methyl]phenyl]-4-[[(1R)-1-phenylethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-N-hydroxyhexanamide.
| Compound Name | 6-[6-[4-[(2-aminoethylamino)methyl]phenyl]-4-[[(1R)-1-phenylethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 24901022 |
| Molecular Formula | C29H37N7O2 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | 6-[6-[4-[(2-aminoethylamino)methyl]phenyl]-4-[[(1R)-1-phenylethyl]amino]pyrrolo[2,3-d]pyrimidin-7-yl]-N-hydroxyhexanamide |
| SMILES | C[C@@H](Nc1ncnc2c1cc(-c1ccc(CNCCN)cc1)n2CCCCCC(=O)NO)c1ccccc1 |
| InChI | InChI=1S/C29H37N7O2/c1-21(23-8-4-2-5-9-23)34-28-25-18-26(24-13-11-22(12-14-24)19-31-16-15-30)36(29(25)33-20-32-28)17-7-3-6-10-27(37)35-38/h2,4-5,8-9,11-14,18,20-21,31,38H,3,6-7,10,15-17,19,30H2,1H3,(H,35,37)(H,32,33,34)/t21-/m1/s1 |
| InChIKey | HLODHAJQUHKYBO-OAQYLSRUSA-N |
| XLogP | 4.39 |
| TPSA | 130.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|