C22H23N8O6- — CID 24901407
(2R)-2-[1-[(2,4-diaminopteridin-6-yl)methyl-oxidoamino]-2,3-dihydroindole-5-carbonyl]hexanedioic acid (PubChem CID 24901407) has the molecular formula C22H23N8O6- and a molecular weight of 495.48 g/mol. Its IUPAC name is (2R)-2-[1-[(2,4-diaminopteridin-6-yl)methyl-oxidoamino]-2,3-dihydroindole-5-carbonyl]hexanedioic acid.
| Compound Name | (2R)-2-[1-[(2,4-diaminopteridin-6-yl)methyl-oxidoamino]-2,3-dihydroindole-5-carbonyl]hexanedioic acid |
|---|---|
| PubChem CID | 24901407 |
| Molecular Formula | C22H23N8O6- |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | (2R)-2-[1-[(2,4-diaminopteridin-6-yl)methyl-oxidoamino]-2,3-dihydroindole-5-carbonyl]hexanedioic acid |
| SMILES | Nc1nc(N)c2nc(CN([O-])N3CCc4cc(C(=O)[C@@H](CCCC(=O)O)C(=O)O)ccc43)cnc2n1 |
| InChI | InChI=1S/C22H23N8O6/c23-19-17-20(28-22(24)27-19)25-9-13(26-17)10-30(36)29-7-6-11-8-12(4-5-15(11)29)18(33)14(21(34)35)2-1-3-16(31)32/h4-5,8-9,14H,1-3,6-7,10H2,(H,31,32)(H,34,35)(H4,23,24,25,27,28)/q-1/t14-/m1/s1 |
| InChIKey | REFYSIBSXSDIEF-CQSZACIVSA-N |
| XLogP | 1.00 |
| TPSA | 224.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|