C27H27N3O2S — CID 24901471
1'-benzyl-5-(4-methoxyphenyl)-5'-methyl-6'-propylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one (PubChem CID 24901471) has the molecular formula C27H27N3O2S and a molecular weight of 457.60 g/mol. Its IUPAC name is 1'-benzyl-5-(4-methoxyphenyl)-5'-methyl-6'-propylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one.
| Compound Name | 1'-benzyl-5-(4-methoxyphenyl)-5'-methyl-6'-propylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 24901471 |
| Molecular Formula | C27H27N3O2S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1'-benzyl-5-(4-methoxyphenyl)-5'-methyl-6'-propylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one |
| SMILES | CCCc1cc2c(cc1C)C1(NN=C(c3ccc(OC)cc3)S1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C27H27N3O2S/c1-4-8-21-16-24-23(15-18(21)2)27(26(31)30(24)17-19-9-6-5-7-10-19)29-28-25(33-27)20-11-13-22(32-3)14-12-20/h5-7,9-16,29H,4,8,17H2,1-3H3 |
| InChIKey | ZAMIHOYHZXTQJV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_5_B(2)', 'substructure': 'N/A'} |
|---|