About Biphenylsulfonamide carboxylate, 4
Biphenylsulfonamide carboxylate, 4 (PubChem CID 24901474) has the molecular formula C17H20N2O4S
and a molecular weight of 348.40 g/mol. Its IUPAC name is (2R)-2-[(3-amino-4-phenylphenyl)sulfonylamino]-3-methylbutanoic acid.
Molecular Properties
| Compound Name | Biphenylsulfonamide carboxylate, 4 |
| PubChem CID | 24901474 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (2R)-2-[(3-amino-4-phenylphenyl)sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](C(=O)O)NS(=O)(=O)C1=CC(=C(C=C1)C2=CC=CC=C2)N |
| InChI | InChI=1S/C17H20N2O4S/c1-11(2)16(17(20)21)19-24(22,23)13-8-9-14(15(18)10-13)12-6-4-3-5-7-12/h3-11,16,19H,18H2,1-2H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | YEKGSQOVPVQUAB-MRXNPFEDSA-N |
| XLogP | 2.80 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | 523 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze Biphenylsulfonamide carboxylate, 4 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Biphenylsulfonamide carboxylate, 4?
The IUPAC name of Biphenylsulfonamide carboxylate, 4 (CID 24901474) is (2R)-2-[(3-amino-4-phenylphenyl)sulfonylamino]-3-methylbutanoic acid.
What is the SMILES notation for Biphenylsulfonamide carboxylate, 4?
The canonical SMILES for Biphenylsulfonamide carboxylate, 4 is CC(C)[C@H](C(=O)O)NS(=O)(=O)C1=CC(=C(C=C1)C2=CC=CC=C2)N.
What is the InChIKey of Biphenylsulfonamide carboxylate, 4?
The InChIKey is YEKGSQOVPVQUAB-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H20N2O4S/c1-11(2)16(17(20)21)19-24(22,23)13-8-9-14(15(18)10-13)12-6-4-3-5-7-12/h3-11,16,19H,18H2,1-2H3,(H,20,21)/t16-/m1/s1.
What are the key properties of Biphenylsulfonamide carboxylate, 4?
Biphenylsulfonamide carboxylate, 4 has a molecular weight of 348.40 g/mol, XLogP of 2.80, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Biphenylsulfonamide carboxylate, 4 is sourced from PubChem (CID 24901474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).