C26H28F2N6O2 — CID 24901509
3-(2,5-difluorophenyl)-N-ethyl-5-[4-(1H-imidazole-5-carbonylamino)butyl]-5-phenyl-4H-pyrazole-1-carboxamide (PubChem CID 24901509) has the molecular formula C26H28F2N6O2 and a molecular weight of 494.55 g/mol. Its IUPAC name is 3-(2,5-difluorophenyl)-N-ethyl-5-[4-(1H-imidazole-5-carbonylamino)butyl]-5-phenyl-4H-pyrazole-1-carboxamide.
| Compound Name | 3-(2,5-difluorophenyl)-N-ethyl-5-[4-(1H-imidazole-5-carbonylamino)butyl]-5-phenyl-4H-pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 24901509 |
| Molecular Formula | C26H28F2N6O2 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 3-(2,5-difluorophenyl)-N-ethyl-5-[4-(1H-imidazole-5-carbonylamino)butyl]-5-phenyl-4H-pyrazole-1-carboxamide |
| SMILES | CCNC(=O)N1N=C(c2cc(F)ccc2F)CC1(CCCCNC(=O)c1cnc[nH]1)c1ccccc1 |
| InChI | InChI=1S/C26H28F2N6O2/c1-2-30-25(36)34-26(18-8-4-3-5-9-18,12-6-7-13-31-24(35)23-16-29-17-32-23)15-22(33-34)20-14-19(27)10-11-21(20)28/h3-5,8-11,14,16-17H,2,6-7,12-13,15H2,1H3,(H,29,32)(H,30,36)(H,31,35) |
| InChIKey | RJXBZPLCHUDNKA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|