About ethyl 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate
ethyl 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 24901533) has the molecular formula C20H23NO2
and a molecular weight of 309.41 g/mol. Its IUPAC name is ethyl 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| PubChem CID | 24901533 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | ethyl 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CCOC(=O)N1Cc2c(ccc(C)c2C)C(c2ccccc2)C1 |
| InChI | InChI=1S/C20H23NO2/c1-4-23-20(22)21-12-18-15(3)14(2)10-11-17(18)19(13-21)16-8-6-5-7-9-16/h5-11,19H,4,12-13H2,1-3H3 |
| InChIKey | PCFSYCHAIKWSDT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The IUPAC name of ethyl 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (CID 24901533) is ethyl 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
What is the SMILES notation for ethyl 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The canonical SMILES for ethyl 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate is CCOC(=O)N1Cc2c(ccc(C)c2C)C(c2ccccc2)C1.
What is the InChIKey of ethyl 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The InChIKey is PCFSYCHAIKWSDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO2/c1-4-23-20(22)21-12-18-15(3)14(2)10-11-17(18)19(13-21)16-8-6-5-7-9-16/h5-11,19H,4,12-13H2,1-3H3.
What are the key properties of ethyl 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate?
ethyl 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate has a molecular weight of 309.41 g/mol, XLogP of 4.41, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxylate is sourced from PubChem (CID 24901533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).