About 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide
7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 24901534) has the molecular formula C18H20N2O
and a molecular weight of 280.37 g/mol. Its IUPAC name is 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide.
Molecular Properties
| Compound Name | 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| PubChem CID | 24901534 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | Cc1ccc2c(c1C)CN(C(N)=O)CC2c1ccccc1 |
| InChI | InChI=1S/C18H20N2O/c1-12-8-9-15-16(13(12)2)10-20(18(19)21)11-17(15)14-6-4-3-5-7-14/h3-9,17H,10-11H2,1-2H3,(H2,19,21) |
| InChIKey | PAHJLODFLYOINM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide?
The IUPAC name of 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide (CID 24901534) is 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide.
What is the SMILES notation for 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide?
The canonical SMILES for 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide is Cc1ccc2c(c1C)CN(C(N)=O)CC2c1ccccc1.
What is the InChIKey of 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide?
The InChIKey is PAHJLODFLYOINM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O/c1-12-8-9-15-16(13(12)2)10-20(18(19)21)11-17(15)14-6-4-3-5-7-14/h3-9,17H,10-11H2,1-2H3,(H2,19,21).
What are the key properties of 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide?
7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide has a molecular weight of 280.37 g/mol, XLogP of 3.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline-2-carboxamide is sourced from PubChem (CID 24901534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).