About 8-ethyl-4-(3-hydroxyphenyl)-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxamide
8-ethyl-4-(3-hydroxyphenyl)-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 24901555) has the molecular formula C20H24N2O2
and a molecular weight of 324.42 g/mol. Its IUPAC name is 8-ethyl-4-(3-hydroxyphenyl)-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxamide.
Molecular Properties
| Compound Name | 8-ethyl-4-(3-hydroxyphenyl)-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| PubChem CID | 24901555 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 8-ethyl-4-(3-hydroxyphenyl)-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | CCc1cccc2c1CN(C(=O)N(C)C)CC2c1cccc(O)c1 |
| InChI | InChI=1S/C20H24N2O2/c1-4-14-7-6-10-17-18(14)12-22(20(24)21(2)3)13-19(17)15-8-5-9-16(23)11-15/h5-11,19,23H,4,12-13H2,1-3H3 |
| InChIKey | SNCKDOOXTVGANV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-ethyl-4-(3-hydroxyphenyl)-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-4-(3-hydroxyphenyl)-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxamide?
The IUPAC name of 8-ethyl-4-(3-hydroxyphenyl)-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxamide (CID 24901555) is 8-ethyl-4-(3-hydroxyphenyl)-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxamide.
What is the SMILES notation for 8-ethyl-4-(3-hydroxyphenyl)-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxamide?
The canonical SMILES for 8-ethyl-4-(3-hydroxyphenyl)-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxamide is CCc1cccc2c1CN(C(=O)N(C)C)CC2c1cccc(O)c1.
What is the InChIKey of 8-ethyl-4-(3-hydroxyphenyl)-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxamide?
The InChIKey is SNCKDOOXTVGANV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O2/c1-4-14-7-6-10-17-18(14)12-22(20(24)21(2)3)13-19(17)15-8-5-9-16(23)11-15/h5-11,19,23H,4,12-13H2,1-3H3.
What are the key properties of 8-ethyl-4-(3-hydroxyphenyl)-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxamide?
8-ethyl-4-(3-hydroxyphenyl)-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxamide has a molecular weight of 324.42 g/mol, XLogP of 3.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-4-(3-hydroxyphenyl)-N,N-dimethyl-3,4-dihydro-1H-isoquinoline-2-carboxamide is sourced from PubChem (CID 24901555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).