C20H23N3O2S — CID 24901585
1-[2-[4-(1,3-benzothiazol-2-yloxy)phenoxy]ethyl]piperidin-4-amine (PubChem CID 24901585) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 1-[2-[4-(1,3-benzothiazol-2-yloxy)phenoxy]ethyl]piperidin-4-amine.
| Compound Name | 1-[2-[4-(1,3-benzothiazol-2-yloxy)phenoxy]ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 24901585 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 1-[2-[4-(1,3-benzothiazol-2-yloxy)phenoxy]ethyl]piperidin-4-amine |
| SMILES | NC1CCN(CCOc2ccc(Oc3nc4ccccc4s3)cc2)CC1 |
| InChI | InChI=1S/C20H23N3O2S/c21-15-9-11-23(12-10-15)13-14-24-16-5-7-17(8-6-16)25-20-22-18-3-1-2-4-19(18)26-20/h1-8,15H,9-14,21H2 |
| InChIKey | RYVZYGCBFLGXIF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |