About (2S)-2-amino-N'-(4-benzylphenyl)pentanediamide
(2S)-2-amino-N'-(4-benzylphenyl)pentanediamide (PubChem CID 24901616) has the molecular formula C18H21N3O2
and a molecular weight of 311.38 g/mol. Its IUPAC name is (2S)-2-amino-N'-(4-benzylphenyl)pentanediamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N'-(4-benzylphenyl)pentanediamide |
| PubChem CID | 24901616 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (2S)-2-amino-N'-(4-benzylphenyl)pentanediamide |
| SMILES | NC(=O)[C@@H](N)CCC(=O)Nc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21N3O2/c19-16(18(20)23)10-11-17(22)21-15-8-6-14(7-9-15)12-13-4-2-1-3-5-13/h1-9,16H,10-12,19H2,(H2,20,23)(H,21,22)/t16-/m0/s1 |
| InChIKey | RYHUMGNBCPJDFD-INIZCTEOSA-N |
| XLogP | 1.81 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-amino-N'-(4-benzylphenyl)pentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N'-(4-benzylphenyl)pentanediamide?
The IUPAC name of (2S)-2-amino-N'-(4-benzylphenyl)pentanediamide (CID 24901616) is (2S)-2-amino-N'-(4-benzylphenyl)pentanediamide.
What is the SMILES notation for (2S)-2-amino-N'-(4-benzylphenyl)pentanediamide?
The canonical SMILES for (2S)-2-amino-N'-(4-benzylphenyl)pentanediamide is NC(=O)[C@@H](N)CCC(=O)Nc1ccc(Cc2ccccc2)cc1.
What is the InChIKey of (2S)-2-amino-N'-(4-benzylphenyl)pentanediamide?
The InChIKey is RYHUMGNBCPJDFD-INIZCTEOSA-N. The full InChI is InChI=1S/C18H21N3O2/c19-16(18(20)23)10-11-17(22)21-15-8-6-14(7-9-15)12-13-4-2-1-3-5-13/h1-9,16H,10-12,19H2,(H2,20,23)(H,21,22)/t16-/m0/s1.
What are the key properties of (2S)-2-amino-N'-(4-benzylphenyl)pentanediamide?
(2S)-2-amino-N'-(4-benzylphenyl)pentanediamide has a molecular weight of 311.38 g/mol, XLogP of 1.81, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N'-(4-benzylphenyl)pentanediamide is sourced from PubChem (CID 24901616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).