About (2S)-2-amino-N-(2-aminoethyl)-N'-(4-phenoxyphenyl)pentanediamide
(2S)-2-amino-N-(2-aminoethyl)-N'-(4-phenoxyphenyl)pentanediamide (PubChem CID 24901635) has the molecular formula C19H24N4O3
and a molecular weight of 356.43 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-aminoethyl)-N'-(4-phenoxyphenyl)pentanediamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N-(2-aminoethyl)-N'-(4-phenoxyphenyl)pentanediamide |
| PubChem CID | 24901635 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (2S)-2-amino-N-(2-aminoethyl)-N'-(4-phenoxyphenyl)pentanediamide |
| SMILES | NCCNC(=O)[C@@H](N)CCC(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H24N4O3/c20-12-13-22-19(25)17(21)10-11-18(24)23-14-6-8-16(9-7-14)26-15-4-2-1-3-5-15/h1-9,17H,10-13,20-21H2,(H,22,25)(H,23,24)/t17-/m0/s1 |
| InChIKey | ZXCLUUNFJWDDPK-KRWDZBQOSA-N |
| XLogP | 1.60 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-amino-N-(2-aminoethyl)-N'-(4-phenoxyphenyl)pentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N-(2-aminoethyl)-N'-(4-phenoxyphenyl)pentanediamide?
The IUPAC name of (2S)-2-amino-N-(2-aminoethyl)-N'-(4-phenoxyphenyl)pentanediamide (CID 24901635) is (2S)-2-amino-N-(2-aminoethyl)-N'-(4-phenoxyphenyl)pentanediamide.
What is the SMILES notation for (2S)-2-amino-N-(2-aminoethyl)-N'-(4-phenoxyphenyl)pentanediamide?
The canonical SMILES for (2S)-2-amino-N-(2-aminoethyl)-N'-(4-phenoxyphenyl)pentanediamide is NCCNC(=O)[C@@H](N)CCC(=O)Nc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of (2S)-2-amino-N-(2-aminoethyl)-N'-(4-phenoxyphenyl)pentanediamide?
The InChIKey is ZXCLUUNFJWDDPK-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H24N4O3/c20-12-13-22-19(25)17(21)10-11-18(24)23-14-6-8-16(9-7-14)26-15-4-2-1-3-5-15/h1-9,17H,10-13,20-21H2,(H,22,25)(H,23,24)/t17-/m0/s1.
What are the key properties of (2S)-2-amino-N-(2-aminoethyl)-N'-(4-phenoxyphenyl)pentanediamide?
(2S)-2-amino-N-(2-aminoethyl)-N'-(4-phenoxyphenyl)pentanediamide has a molecular weight of 356.43 g/mol, XLogP of 1.60, 9 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N-(2-aminoethyl)-N'-(4-phenoxyphenyl)pentanediamide is sourced from PubChem (CID 24901635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).