About (4S)-4,5-diamino-N-(4-phenoxyphenyl)pentanamide
(4S)-4,5-diamino-N-(4-phenoxyphenyl)pentanamide (PubChem CID 24901637) has the molecular formula C17H21N3O2
and a molecular weight of 299.37 g/mol. Its IUPAC name is (4S)-4,5-diamino-N-(4-phenoxyphenyl)pentanamide.
Molecular Properties
| Compound Name | (4S)-4,5-diamino-N-(4-phenoxyphenyl)pentanamide |
| PubChem CID | 24901637 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | (4S)-4,5-diamino-N-(4-phenoxyphenyl)pentanamide |
| SMILES | NC[C@@H](N)CCC(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C17H21N3O2/c18-12-13(19)6-11-17(21)20-14-7-9-16(10-8-14)22-15-4-2-1-3-5-15/h1-5,7-10,13H,6,11-12,18-19H2,(H,20,21)/t13-/m0/s1 |
| InChIKey | YUSYHJFOQGXULG-ZDUSSCGKSA-N |
| XLogP | 2.48 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S)-4,5-diamino-N-(4-phenoxyphenyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4,5-diamino-N-(4-phenoxyphenyl)pentanamide?
The IUPAC name of (4S)-4,5-diamino-N-(4-phenoxyphenyl)pentanamide (CID 24901637) is (4S)-4,5-diamino-N-(4-phenoxyphenyl)pentanamide.
What is the SMILES notation for (4S)-4,5-diamino-N-(4-phenoxyphenyl)pentanamide?
The canonical SMILES for (4S)-4,5-diamino-N-(4-phenoxyphenyl)pentanamide is NC[C@@H](N)CCC(=O)Nc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of (4S)-4,5-diamino-N-(4-phenoxyphenyl)pentanamide?
The InChIKey is YUSYHJFOQGXULG-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H21N3O2/c18-12-13(19)6-11-17(21)20-14-7-9-16(10-8-14)22-15-4-2-1-3-5-15/h1-5,7-10,13H,6,11-12,18-19H2,(H,20,21)/t13-/m0/s1.
What are the key properties of (4S)-4,5-diamino-N-(4-phenoxyphenyl)pentanamide?
(4S)-4,5-diamino-N-(4-phenoxyphenyl)pentanamide has a molecular weight of 299.37 g/mol, XLogP of 2.48, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4,5-diamino-N-(4-phenoxyphenyl)pentanamide is sourced from PubChem (CID 24901637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).