About N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-phenylacetamide
N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-phenylacetamide (PubChem CID 24901699) has the molecular formula C22H16FN3O2S2
and a molecular weight of 437.52 g/mol. Its IUPAC name is N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-phenylacetamide.
Molecular Properties
| Compound Name | N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-phenylacetamide |
| PubChem CID | 24901699 |
| Molecular Formula | C22H16FN3O2S2 |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NC(=S)Nc1ccc(Oc2ccnc3ccsc23)c(F)c1 |
| InChI | InChI=1S/C22H16FN3O2S2/c23-16-13-15(25-22(29)26-20(27)12-14-4-2-1-3-5-14)6-7-18(16)28-19-8-10-24-17-9-11-30-21(17)19/h1-11,13H,12H2,(H2,25,26,27,29) |
| InChIKey | DNBVMOXDARBOEE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-phenylacetamide?
The IUPAC name of N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-phenylacetamide (CID 24901699) is N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-phenylacetamide.
What is the SMILES notation for N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-phenylacetamide?
The canonical SMILES for N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-phenylacetamide is O=C(Cc1ccccc1)NC(=S)Nc1ccc(Oc2ccnc3ccsc23)c(F)c1.
What is the InChIKey of N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-phenylacetamide?
The InChIKey is DNBVMOXDARBOEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16FN3O2S2/c23-16-13-15(25-22(29)26-20(27)12-14-4-2-1-3-5-14)6-7-18(16)28-19-8-10-24-17-9-11-30-21(17)19/h1-11,13H,12H2,(H2,25,26,27,29).
What are the key properties of N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-phenylacetamide?
N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-phenylacetamide has a molecular weight of 437.52 g/mol, XLogP of 5.28, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-fluoro-4-thieno[3,2-b]pyridin-7-yloxyphenyl)carbamothioyl]-2-phenylacetamide is sourced from PubChem (CID 24901699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).