C24H16FN5O2S3 — CID 24901712
N-[[3-fluoro-4-[2-(1,3,4-thiadiazol-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 24901712) has the molecular formula C24H16FN5O2S3 and a molecular weight of 521.62 g/mol. Its IUPAC name is N-[[3-fluoro-4-[2-(1,3,4-thiadiazol-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[3-fluoro-4-[2-(1,3,4-thiadiazol-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 24901712 |
| Molecular Formula | C24H16FN5O2S3 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | N-[[3-fluoro-4-[2-(1,3,4-thiadiazol-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NC(=S)Nc1ccc(Oc2ccnc3cc(-c4nncs4)sc23)c(F)c1 |
| InChI | InChI=1S/C24H16FN5O2S3/c25-16-11-15(28-24(33)29-21(31)10-14-4-2-1-3-5-14)6-7-18(16)32-19-8-9-26-17-12-20(35-22(17)19)23-30-27-13-34-23/h1-9,11-13H,10H2,(H2,28,29,31,33) |
| InChIKey | JVYQBIGQNUDXIK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|