C11H14N2O3 — CID 24902885
methyl (2S,4R)-4-pyridin-2-yloxypyrrolidine-2-carboxylate (PubChem CID 24902885) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is methyl (2S,4R)-4-pyridin-2-yloxypyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-4-pyridin-2-yloxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 24902885 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | methyl (2S,4R)-4-pyridin-2-yloxypyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](Oc2ccccn2)CN1 |
| InChI | InChI=1S/C11H14N2O3/c1-15-11(14)9-6-8(7-13-9)16-10-4-2-3-5-12-10/h2-5,8-9,13H,6-7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | MOMHGCLEPKQNGY-BDAKNGLRSA-N |
| XLogP | 0.36 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |