About 3,3-difluoropyrrolidine;hydrochloride
3,3-difluoropyrrolidine;hydrochloride (PubChem CID 24903482) has the molecular formula C4H8ClF2N
and a molecular weight of 143.56 g/mol. Its IUPAC name is 3,3-difluoropyrrolidine;hydrochloride.
Molecular Properties
| Compound Name | 3,3-difluoropyrrolidine;hydrochloride |
| PubChem CID | 24903482 |
| Molecular Formula | C4H8ClF2N |
| Molecular Weight | 143.56 g/mol |
| Exact Mass | 143.03 |
| IUPAC Name | 3,3-difluoropyrrolidine;hydrochloride |
| SMILES | Cl.FC1(F)CCNC1 |
| InChI | InChI=1S/C4H7F2N.ClH/c5-4(6)1-2-7-3-4;/h7H,1-3H2;1H |
| InChIKey | YYVPZQADFREIFR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.56 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-difluoropyrrolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoropyrrolidine;hydrochloride?
The IUPAC name of 3,3-difluoropyrrolidine;hydrochloride (CID 24903482) is 3,3-difluoropyrrolidine;hydrochloride.
What is the SMILES notation for 3,3-difluoropyrrolidine;hydrochloride?
The canonical SMILES for 3,3-difluoropyrrolidine;hydrochloride is Cl.FC1(F)CCNC1.
What is the InChIKey of 3,3-difluoropyrrolidine;hydrochloride?
The InChIKey is YYVPZQADFREIFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7F2N.ClH/c5-4(6)1-2-7-3-4;/h7H,1-3H2;1H.
What are the key properties of 3,3-difluoropyrrolidine;hydrochloride?
3,3-difluoropyrrolidine;hydrochloride has a molecular weight of 143.56 g/mol, XLogP of 1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoropyrrolidine;hydrochloride is sourced from PubChem (CID 24903482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).