About 2-tert-butyl-4,6-dichloropyrimidine
2-tert-butyl-4,6-dichloropyrimidine (PubChem CID 24903688) has the molecular formula C8H10Cl2N2
and a molecular weight of 205.09 g/mol. Its IUPAC name is 2-tert-butyl-4,6-dichloropyrimidine.
Molecular Properties
| Compound Name | 2-tert-butyl-4,6-dichloropyrimidine |
| PubChem CID | 24903688 |
| Molecular Formula | C8H10Cl2N2 |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 2-tert-butyl-4,6-dichloropyrimidine |
| SMILES | CC(C)(C)c1nc(Cl)cc(Cl)n1 |
| InChI | InChI=1S/C8H10Cl2N2/c1-8(2,3)7-11-5(9)4-6(10)12-7/h4H,1-3H3 |
| InChIKey | INTDGBJUITUUCN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-4,6-dichloropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4,6-dichloropyrimidine?
The IUPAC name of 2-tert-butyl-4,6-dichloropyrimidine (CID 24903688) is 2-tert-butyl-4,6-dichloropyrimidine.
What is the SMILES notation for 2-tert-butyl-4,6-dichloropyrimidine?
The canonical SMILES for 2-tert-butyl-4,6-dichloropyrimidine is CC(C)(C)c1nc(Cl)cc(Cl)n1.
What is the InChIKey of 2-tert-butyl-4,6-dichloropyrimidine?
The InChIKey is INTDGBJUITUUCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10Cl2N2/c1-8(2,3)7-11-5(9)4-6(10)12-7/h4H,1-3H3.
What are the key properties of 2-tert-butyl-4,6-dichloropyrimidine?
2-tert-butyl-4,6-dichloropyrimidine has a molecular weight of 205.09 g/mol, XLogP of 3.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4,6-dichloropyrimidine is sourced from PubChem (CID 24903688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).