C28H29ClN4O2S — CID 2490370
(2S)-2-[[5-(4-chlorophenyl)-4-(2-ethoxyethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dimethylphenyl)-2-phenylacetamide (PubChem CID 2490370) has the molecular formula C28H29ClN4O2S and a molecular weight of 521.09 g/mol. Its IUPAC name is (2S)-2-[[5-(4-chlorophenyl)-4-(2-ethoxyethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dimethylphenyl)-2-phenylacetamide.
| Compound Name | (2S)-2-[[5-(4-chlorophenyl)-4-(2-ethoxyethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dimethylphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 2490370 |
| Molecular Formula | C28H29ClN4O2S |
| Molecular Weight | 521.09 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | (2S)-2-[[5-(4-chlorophenyl)-4-(2-ethoxyethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dimethylphenyl)-2-phenylacetamide |
| SMILES | CCOCCn1c(S[C@H](C(=O)Nc2cc(C)ccc2C)c2ccccc2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H29ClN4O2S/c1-4-35-17-16-33-26(22-12-14-23(29)15-13-22)31-32-28(33)36-25(21-8-6-5-7-9-21)27(34)30-24-18-19(2)10-11-20(24)3/h5-15,18,25H,4,16-17H2,1-3H3,(H,30,34)/t25-/m0/s1 |
| InChIKey | UBWZYJUKRQQOJJ-VWLOTQADSA-N |
| XLogP | 6.72 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.09 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|