C14H18ClNO2 — CID 24905028
(3S)-1-[(2-chloro-6-methylphenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 24905028) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is (3S)-1-[(2-chloro-6-methylphenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[(2-chloro-6-methylphenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 24905028 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (3S)-1-[(2-chloro-6-methylphenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | Cc1cccc(Cl)c1CN1CCC[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C14H18ClNO2/c1-10-4-2-6-13(15)12(10)9-16-7-3-5-11(8-16)14(17)18/h2,4,6,11H,3,5,7-9H2,1H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | QYFXBCPQUIXUIE-NSHDSACASA-N |
| XLogP | 2.95 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |