C16H13N5 — CID 24905144
1-methyl-3-naphthalen-2-ylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 24905144) has the molecular formula C16H13N5 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-methyl-3-naphthalen-2-ylpyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-methyl-3-naphthalen-2-ylpyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 24905144 |
| Molecular Formula | C16H13N5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 1-methyl-3-naphthalen-2-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cn1nc(-c2ccc3ccccc3c2)c2c(N)ncnc21 |
| InChI | InChI=1S/C16H13N5/c1-21-16-13(15(17)18-9-19-16)14(20-21)12-7-6-10-4-2-3-5-11(10)8-12/h2-9H,1H3,(H2,17,18,19) |
| InChIKey | UOKGZPYGRJDACN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |