About 3-(2,3-dimethoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine
3-(2,3-dimethoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 24905178) has the molecular formula C16H19N5O2
and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-(2,3-dimethoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 3-(2,3-dimethoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 24905178 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-(2,3-dimethoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | COc1cccc(-c2nn(C(C)C)c3ncnc(N)c23)c1OC |
| InChI | InChI=1S/C16H19N5O2/c1-9(2)21-16-12(15(17)18-8-19-16)13(20-21)10-6-5-7-11(22-3)14(10)23-4/h5-9H,1-4H3,(H2,17,18,19) |
| InChIKey | ZXLCCABWVQDAOS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(2,3-dimethoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dimethoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 3-(2,3-dimethoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine (CID 24905178) is 3-(2,3-dimethoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 3-(2,3-dimethoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 3-(2,3-dimethoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine is COc1cccc(-c2nn(C(C)C)c3ncnc(N)c23)c1OC.
What is the InChIKey of 3-(2,3-dimethoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is ZXLCCABWVQDAOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N5O2/c1-9(2)21-16-12(15(17)18-8-19-16)13(20-21)10-6-5-7-11(22-3)14(10)23-4/h5-9H,1-4H3,(H2,17,18,19).
What are the key properties of 3-(2,3-dimethoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine?
3-(2,3-dimethoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 313.36 g/mol, XLogP of 2.67, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dimethoxyphenyl)-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 24905178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).