C12H18O3 — CID 24905348
(2R,3aS,9aS)-2-methoxy-2-methyl-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran (PubChem CID 24905348) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (2R,3aS,9aS)-2-methoxy-2-methyl-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran.
| Compound Name | (2R,3aS,9aS)-2-methoxy-2-methyl-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran |
|---|---|
| PubChem CID | 24905348 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (2R,3aS,9aS)-2-methoxy-2-methyl-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran |
| SMILES | CO[C@@]1(C)C[C@@H]2OCC3=CCCC[C@]32O1 |
| InChI | InChI=1S/C12H18O3/c1-11(13-2)7-10-12(15-11)6-4-3-5-9(12)8-14-10/h5,10H,3-4,6-8H2,1-2H3/t10-,11+,12-/m0/s1 |
| InChIKey | WISNWCFAUUXHCB-TUAOUCFPSA-N |
| XLogP | 2.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|