About bis(2,2-dimethylpropanoate);palladium(2+)
bis(2,2-dimethylpropanoate);palladium(2+) (PubChem CID 24905427) has the molecular formula C10H18O4Pd
and a molecular weight of 308.67 g/mol. Its IUPAC name is bis(2,2-dimethylpropanoate);palladium(2+).
Molecular Properties
| Compound Name | bis(2,2-dimethylpropanoate);palladium(2+) |
| PubChem CID | 24905427 |
| Molecular Formula | C10H18O4Pd |
| Molecular Weight | 308.67 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | bis(2,2-dimethylpropanoate);palladium(2+) |
| SMILES | CC(C)(C)C(=O)[O-].CC(C)(C)C(=O)[O-].[Pd+2] |
| InChI | InChI=1S/2C5H10O2.Pd/c2*1-5(2,3)4(6)7;/h2*1-3H3,(H,6,7);/q;;+2/p-2 |
| InChIKey | PAGZTSLSNQZYEV-UHFFFAOYSA-L |
| XLogP | -0.44 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.67 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2,2-dimethylpropanoate);palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,2-dimethylpropanoate);palladium(2+)?
The IUPAC name of bis(2,2-dimethylpropanoate);palladium(2+) (CID 24905427) is bis(2,2-dimethylpropanoate);palladium(2+).
What is the SMILES notation for bis(2,2-dimethylpropanoate);palladium(2+)?
The canonical SMILES for bis(2,2-dimethylpropanoate);palladium(2+) is CC(C)(C)C(=O)[O-].CC(C)(C)C(=O)[O-].[Pd+2].
What is the InChIKey of bis(2,2-dimethylpropanoate);palladium(2+)?
The InChIKey is PAGZTSLSNQZYEV-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H10O2.Pd/c2*1-5(2,3)4(6)7;/h2*1-3H3,(H,6,7);/q;;+2/p-2.
What are the key properties of bis(2,2-dimethylpropanoate);palladium(2+)?
bis(2,2-dimethylpropanoate);palladium(2+) has a molecular weight of 308.67 g/mol, XLogP of -0.44, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,2-dimethylpropanoate);palladium(2+) is sourced from PubChem (CID 24905427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).