About 3-(2-methoxyphenyl)-2H-1,4-benzothiazine
3-(2-methoxyphenyl)-2H-1,4-benzothiazine (PubChem CID 24905600) has the molecular formula C15H13NOS
and a molecular weight of 255.34 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-2H-1,4-benzothiazine.
Molecular Properties
| Compound Name | 3-(2-methoxyphenyl)-2H-1,4-benzothiazine |
| PubChem CID | 24905600 |
| Molecular Formula | C15H13NOS |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-(2-methoxyphenyl)-2H-1,4-benzothiazine |
| SMILES | COc1ccccc1C1=Nc2ccccc2SC1 |
| InChI | InChI=1S/C15H13NOS/c1-17-14-8-4-2-6-11(14)13-10-18-15-9-5-3-7-12(15)16-13/h2-9H,10H2,1H3 |
| InChIKey | GKSOEAMTCORTLG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-methoxyphenyl)-2H-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methoxyphenyl)-2H-1,4-benzothiazine?
The IUPAC name of 3-(2-methoxyphenyl)-2H-1,4-benzothiazine (CID 24905600) is 3-(2-methoxyphenyl)-2H-1,4-benzothiazine.
What is the SMILES notation for 3-(2-methoxyphenyl)-2H-1,4-benzothiazine?
The canonical SMILES for 3-(2-methoxyphenyl)-2H-1,4-benzothiazine is COc1ccccc1C1=Nc2ccccc2SC1.
What is the InChIKey of 3-(2-methoxyphenyl)-2H-1,4-benzothiazine?
The InChIKey is GKSOEAMTCORTLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NOS/c1-17-14-8-4-2-6-11(14)13-10-18-15-9-5-3-7-12(15)16-13/h2-9H,10H2,1H3.
What are the key properties of 3-(2-methoxyphenyl)-2H-1,4-benzothiazine?
3-(2-methoxyphenyl)-2H-1,4-benzothiazine has a molecular weight of 255.34 g/mol, XLogP of 3.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxyphenyl)-2H-1,4-benzothiazine is sourced from PubChem (CID 24905600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).