About 5-fluoro-1'-[(4-methoxyphenyl)methyl]spiro[1,3-dihydroindene-2,3'-indole]-2'-one
5-fluoro-1'-[(4-methoxyphenyl)methyl]spiro[1,3-dihydroindene-2,3'-indole]-2'-one (PubChem CID 24905732) has the molecular formula C24H20FNO2
and a molecular weight of 373.43 g/mol. Its IUPAC name is 5-fluoro-1'-[(4-methoxyphenyl)methyl]spiro[1,3-dihydroindene-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 5-fluoro-1'-[(4-methoxyphenyl)methyl]spiro[1,3-dihydroindene-2,3'-indole]-2'-one |
| PubChem CID | 24905732 |
| Molecular Formula | C24H20FNO2 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 5-fluoro-1'-[(4-methoxyphenyl)methyl]spiro[1,3-dihydroindene-2,3'-indole]-2'-one |
| SMILES | COc1ccc(CN2C(=O)C3(Cc4ccc(F)cc4C3)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H20FNO2/c1-28-20-10-6-16(7-11-20)15-26-22-5-3-2-4-21(22)24(23(26)27)13-17-8-9-19(25)12-18(17)14-24/h2-12H,13-15H2,1H3 |
| InChIKey | STGYVERQAKGIPE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-1'-[(4-methoxyphenyl)methyl]spiro[1,3-dihydroindene-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1'-[(4-methoxyphenyl)methyl]spiro[1,3-dihydroindene-2,3'-indole]-2'-one?
The IUPAC name of 5-fluoro-1'-[(4-methoxyphenyl)methyl]spiro[1,3-dihydroindene-2,3'-indole]-2'-one (CID 24905732) is 5-fluoro-1'-[(4-methoxyphenyl)methyl]spiro[1,3-dihydroindene-2,3'-indole]-2'-one.
What is the SMILES notation for 5-fluoro-1'-[(4-methoxyphenyl)methyl]spiro[1,3-dihydroindene-2,3'-indole]-2'-one?
The canonical SMILES for 5-fluoro-1'-[(4-methoxyphenyl)methyl]spiro[1,3-dihydroindene-2,3'-indole]-2'-one is COc1ccc(CN2C(=O)C3(Cc4ccc(F)cc4C3)c3ccccc32)cc1.
What is the InChIKey of 5-fluoro-1'-[(4-methoxyphenyl)methyl]spiro[1,3-dihydroindene-2,3'-indole]-2'-one?
The InChIKey is STGYVERQAKGIPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20FNO2/c1-28-20-10-6-16(7-11-20)15-26-22-5-3-2-4-21(22)24(23(26)27)13-17-8-9-19(25)12-18(17)14-24/h2-12H,13-15H2,1H3.
What are the key properties of 5-fluoro-1'-[(4-methoxyphenyl)methyl]spiro[1,3-dihydroindene-2,3'-indole]-2'-one?
5-fluoro-1'-[(4-methoxyphenyl)methyl]spiro[1,3-dihydroindene-2,3'-indole]-2'-one has a molecular weight of 373.43 g/mol, XLogP of 4.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1'-[(4-methoxyphenyl)methyl]spiro[1,3-dihydroindene-2,3'-indole]-2'-one is sourced from PubChem (CID 24905732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).