About (2R)-1-(3,4-dichlorophenyl)sulfonyl-2-methyl-4-[2-(trifluoromethyl)phenyl]piperazine
(2R)-1-(3,4-dichlorophenyl)sulfonyl-2-methyl-4-[2-(trifluoromethyl)phenyl]piperazine (PubChem CID 24906061) has the molecular formula C18H17Cl2F3N2O2S
and a molecular weight of 453.31 g/mol. Its IUPAC name is (2R)-1-(3,4-dichlorophenyl)sulfonyl-2-methyl-4-[2-(trifluoromethyl)phenyl]piperazine.
Molecular Properties
| Compound Name | (2R)-1-(3,4-dichlorophenyl)sulfonyl-2-methyl-4-[2-(trifluoromethyl)phenyl]piperazine |
| PubChem CID | 24906061 |
| Molecular Formula | C18H17Cl2F3N2O2S |
| Molecular Weight | 453.31 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | (2R)-1-(3,4-dichlorophenyl)sulfonyl-2-methyl-4-[2-(trifluoromethyl)phenyl]piperazine |
| SMILES | C[C@@H]1CN(c2ccccc2C(F)(F)F)CCN1S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2F3N2O2S/c1-12-11-24(17-5-3-2-4-14(17)18(21,22)23)8-9-25(12)28(26,27)13-6-7-15(19)16(20)10-13/h2-7,10,12H,8-9,11H2,1H3/t12-/m1/s1 |
| InChIKey | JEEXNJWEDOIWGR-GFCCVEGCSA-N |
| XLogP | 4.91 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.31 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-1-(3,4-dichlorophenyl)sulfonyl-2-methyl-4-[2-(trifluoromethyl)phenyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-(3,4-dichlorophenyl)sulfonyl-2-methyl-4-[2-(trifluoromethyl)phenyl]piperazine?
The IUPAC name of (2R)-1-(3,4-dichlorophenyl)sulfonyl-2-methyl-4-[2-(trifluoromethyl)phenyl]piperazine (CID 24906061) is (2R)-1-(3,4-dichlorophenyl)sulfonyl-2-methyl-4-[2-(trifluoromethyl)phenyl]piperazine.
What is the SMILES notation for (2R)-1-(3,4-dichlorophenyl)sulfonyl-2-methyl-4-[2-(trifluoromethyl)phenyl]piperazine?
The canonical SMILES for (2R)-1-(3,4-dichlorophenyl)sulfonyl-2-methyl-4-[2-(trifluoromethyl)phenyl]piperazine is C[C@@H]1CN(c2ccccc2C(F)(F)F)CCN1S(=O)(=O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of (2R)-1-(3,4-dichlorophenyl)sulfonyl-2-methyl-4-[2-(trifluoromethyl)phenyl]piperazine?
The InChIKey is JEEXNJWEDOIWGR-GFCCVEGCSA-N. The full InChI is InChI=1S/C18H17Cl2F3N2O2S/c1-12-11-24(17-5-3-2-4-14(17)18(21,22)23)8-9-25(12)28(26,27)13-6-7-15(19)16(20)10-13/h2-7,10,12H,8-9,11H2,1H3/t12-/m1/s1.
What are the key properties of (2R)-1-(3,4-dichlorophenyl)sulfonyl-2-methyl-4-[2-(trifluoromethyl)phenyl]piperazine?
(2R)-1-(3,4-dichlorophenyl)sulfonyl-2-methyl-4-[2-(trifluoromethyl)phenyl]piperazine has a molecular weight of 453.31 g/mol, XLogP of 4.91, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-(3,4-dichlorophenyl)sulfonyl-2-methyl-4-[2-(trifluoromethyl)phenyl]piperazine is sourced from PubChem (CID 24906061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).