About (2R)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-(oxan-4-yl)propanamide
(2R)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-(oxan-4-yl)propanamide (PubChem CID 24906118) has the molecular formula C18H21FN2O4S2
and a molecular weight of 412.51 g/mol. Its IUPAC name is (2R)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-(oxan-4-yl)propanamide.
Molecular Properties
| Compound Name | (2R)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-(oxan-4-yl)propanamide |
| PubChem CID | 24906118 |
| Molecular Formula | C18H21FN2O4S2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | (2R)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-(oxan-4-yl)propanamide |
| SMILES | CS(=O)(=O)c1ccc([C@@H](CC2CCOCC2)C(=O)Nc2ncc(F)s2)cc1 |
| InChI | InChI=1S/C18H21FN2O4S2/c1-27(23,24)14-4-2-13(3-5-14)15(10-12-6-8-25-9-7-12)17(22)21-18-20-11-16(19)26-18/h2-5,11-12,15H,6-10H2,1H3,(H,20,21,22)/t15-/m1/s1 |
| InChIKey | IERGAZGAANLJJZ-OAHLLOKOSA-N |
| XLogP | 3.22 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2R)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-(oxan-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-(oxan-4-yl)propanamide?
The IUPAC name of (2R)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-(oxan-4-yl)propanamide (CID 24906118) is (2R)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-(oxan-4-yl)propanamide.
What is the SMILES notation for (2R)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-(oxan-4-yl)propanamide?
The canonical SMILES for (2R)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-(oxan-4-yl)propanamide is CS(=O)(=O)c1ccc([C@@H](CC2CCOCC2)C(=O)Nc2ncc(F)s2)cc1.
What is the InChIKey of (2R)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-(oxan-4-yl)propanamide?
The InChIKey is IERGAZGAANLJJZ-OAHLLOKOSA-N. The full InChI is InChI=1S/C18H21FN2O4S2/c1-27(23,24)14-4-2-13(3-5-14)15(10-12-6-8-25-9-7-12)17(22)21-18-20-11-16(19)26-18/h2-5,11-12,15H,6-10H2,1H3,(H,20,21,22)/t15-/m1/s1.
What are the key properties of (2R)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-(oxan-4-yl)propanamide?
(2R)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-(oxan-4-yl)propanamide has a molecular weight of 412.51 g/mol, XLogP of 3.22, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-(5-fluoro-1,3-thiazol-2-yl)-2-(4-methylsulfonylphenyl)-3-(oxan-4-yl)propanamide is sourced from PubChem (CID 24906118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).