C16H15BrN4OS — CID 24908017
6-[(5-bromo-1H-indol-3-yl)methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 24908017) has the molecular formula C16H15BrN4OS and a molecular weight of 391.29 g/mol. Its IUPAC name is 6-[(5-bromo-1H-indol-3-yl)methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(5-bromo-1H-indol-3-yl)methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24908017 |
| Molecular Formula | C16H15BrN4OS |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 6-[(5-bromo-1H-indol-3-yl)methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2c1CN(Cc1c[nH]c3ccc(Br)cc13)CC2 |
| InChI | InChI=1S/C16H15BrN4OS/c17-10-1-2-13-11(5-10)9(6-18-13)7-21-4-3-14-12(8-21)15(22)20-16(23)19-14/h1-2,5-6,18H,3-4,7-8H2,(H2,19,20,22,23) |
| InChIKey | NLMGJSNFOVASRE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|