C23H27N3 — CID 24908452
2-phenyl-6-[(4-prop-1-en-2-ylcyclohexen-1-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 24908452) has the molecular formula C23H27N3 and a molecular weight of 345.49 g/mol. Its IUPAC name is 2-phenyl-6-[(4-prop-1-en-2-ylcyclohexen-1-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 2-phenyl-6-[(4-prop-1-en-2-ylcyclohexen-1-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 24908452 |
| Molecular Formula | C23H27N3 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 2-phenyl-6-[(4-prop-1-en-2-ylcyclohexen-1-yl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | C=C(C)C1CC=C(CN2CCc3nc(-c4ccccc4)ncc3C2)CC1 |
| InChI | InChI=1S/C23H27N3/c1-17(2)19-10-8-18(9-11-19)15-26-13-12-22-21(16-26)14-24-23(25-22)20-6-4-3-5-7-20/h3-8,14,19H,1,9-13,15-16H2,2H3 |
| InChIKey | DUGPTFYLDUQCTR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|