C18H17N3O4S — CID 24908563
5-[(2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-sulfonic acid (PubChem CID 24908563) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is 5-[(2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-sulfonic acid.
| Compound Name | 5-[(2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-sulfonic acid |
|---|---|
| PubChem CID | 24908563 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 5-[(2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]furan-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(CN2CCc3nc(-c4ccccc4)ncc3C2)o1 |
| InChI | InChI=1S/C18H17N3O4S/c22-26(23,24)17-7-6-15(25-17)12-21-9-8-16-14(11-21)10-19-18(20-16)13-4-2-1-3-5-13/h1-7,10H,8-9,11-12H2,(H,22,23,24) |
| InChIKey | AMPYYYCFSQBITD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|