C24H20Cl2N4O — CID 24909993
4-[6-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline (PubChem CID 24909993) has the molecular formula C24H20Cl2N4O and a molecular weight of 451.36 g/mol. Its IUPAC name is 4-[6-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline.
| Compound Name | 4-[6-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 24909993 |
| Molecular Formula | C24H20Cl2N4O |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 4-[6-[[5-(2,4-dichlorophenyl)furan-2-yl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
| SMILES | Nc1ccc(-c2ncc3c(n2)CCN(Cc2ccc(-c4ccc(Cl)cc4Cl)o2)C3)cc1 |
| InChI | InChI=1S/C24H20Cl2N4O/c25-17-3-7-20(21(26)11-17)23-8-6-19(31-23)14-30-10-9-22-16(13-30)12-28-24(29-22)15-1-4-18(27)5-2-15/h1-8,11-12H,9-10,13-14,27H2 |
| InChIKey | BAUJEOFPLSOWFQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|