C14H15FN4O2S — CID 24913097
6-[(2-fluoro-3-pyridinyl)methyl]-2-methylsulfonyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 24913097) has the molecular formula C14H15FN4O2S and a molecular weight of 322.37 g/mol. Its IUPAC name is 6-[(2-fluoro-3-pyridinyl)methyl]-2-methylsulfonyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 6-[(2-fluoro-3-pyridinyl)methyl]-2-methylsulfonyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 24913097 |
| Molecular Formula | C14H15FN4O2S |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 6-[(2-fluoro-3-pyridinyl)methyl]-2-methylsulfonyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | CS(=O)(=O)c1ncc2c(n1)CCN(Cc1cccnc1F)C2 |
| InChI | InChI=1S/C14H15FN4O2S/c1-22(20,21)14-17-7-11-9-19(6-4-12(11)18-14)8-10-3-2-5-16-13(10)15/h2-3,5,7H,4,6,8-9H2,1H3 |
| InChIKey | OEAKTLUHMADAHJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|