C25H21Cl2N5 — CID 24914424
4-[6-[[6-(3,5-dichlorophenyl)-3-pyridinyl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline (PubChem CID 24914424) has the molecular formula C25H21Cl2N5 and a molecular weight of 462.38 g/mol. Its IUPAC name is 4-[6-[[6-(3,5-dichlorophenyl)-3-pyridinyl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline.
| Compound Name | 4-[6-[[6-(3,5-dichlorophenyl)-3-pyridinyl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 24914424 |
| Molecular Formula | C25H21Cl2N5 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 4-[6-[[6-(3,5-dichlorophenyl)-3-pyridinyl]methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-2-yl]aniline |
| SMILES | Nc1ccc(-c2ncc3c(n2)CCN(Cc2ccc(-c4cc(Cl)cc(Cl)c4)nc2)C3)cc1 |
| InChI | InChI=1S/C25H21Cl2N5/c26-20-9-18(10-21(27)11-20)23-6-1-16(12-29-23)14-32-8-7-24-19(15-32)13-30-25(31-24)17-2-4-22(28)5-3-17/h1-6,9-13H,7-8,14-15,28H2 |
| InChIKey | GQKUIXFCGIYLDK-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|