C19H16ClFN4 — CID 24914791
6-[(5-chloro-2-fluoro-3-pyridinyl)methyl]-2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 24914791) has the molecular formula C19H16ClFN4 and a molecular weight of 354.82 g/mol. Its IUPAC name is 6-[(5-chloro-2-fluoro-3-pyridinyl)methyl]-2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 6-[(5-chloro-2-fluoro-3-pyridinyl)methyl]-2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 24914791 |
| Molecular Formula | C19H16ClFN4 |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 6-[(5-chloro-2-fluoro-3-pyridinyl)methyl]-2-phenyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | Fc1ncc(Cl)cc1CN1CCc2nc(-c3ccccc3)ncc2C1 |
| InChI | InChI=1S/C19H16ClFN4/c20-16-8-14(18(21)22-10-16)11-25-7-6-17-15(12-25)9-23-19(24-17)13-4-2-1-3-5-13/h1-5,8-10H,6-7,11-12H2 |
| InChIKey | JZVIPGUYOUTKMC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|