About [(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] phosphate
[(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] phosphate (PubChem CID 24916775) has the molecular formula C9H12NO7P-2
and a molecular weight of 277.17 g/mol. Its IUPAC name is [(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] phosphate.
Molecular Properties
| Compound Name | [(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] phosphate |
| PubChem CID | 24916775 |
| Molecular Formula | C9H12NO7P-2 |
| Molecular Weight | 277.17 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | [(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] phosphate |
| SMILES | O=P([O-])([O-])OC[C@@H](O)[C@@H](O)Nc1ccccc1O |
| InChI | InChI=1S/C9H14NO7P/c11-7-4-2-1-3-6(7)10-9(13)8(12)5-17-18(14,15)16/h1-4,8-13H,5H2,(H2,14,15,16)/p-2/t8-,9-/m1/s1 |
| InChIKey | SPOVITMZOKMJPQ-RKDXNWHRSA-L |
| XLogP | -1.67 |
| TPSA | 145.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.17 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] phosphate?
The IUPAC name of [(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] phosphate (CID 24916775) is [(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] phosphate.
What is the SMILES notation for [(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] phosphate?
The canonical SMILES for [(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] phosphate is O=P([O-])([O-])OC[C@@H](O)[C@@H](O)Nc1ccccc1O.
What is the InChIKey of [(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] phosphate?
The InChIKey is SPOVITMZOKMJPQ-RKDXNWHRSA-L. The full InChI is InChI=1S/C9H14NO7P/c11-7-4-2-1-3-6(7)10-9(13)8(12)5-17-18(14,15)16/h1-4,8-13H,5H2,(H2,14,15,16)/p-2/t8-,9-/m1/s1.
What are the key properties of [(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] phosphate?
[(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] phosphate has a molecular weight of 277.17 g/mol, XLogP of -1.67, 6 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-2,3-dihydroxy-3-(2-hydroxyanilino)propyl] phosphate is sourced from PubChem (CID 24916775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).