C22H22F3N4O2S+ — CID 24916926
[(3R,4R)-1-[6-(3-methylsulfonylphenyl)pyrimidin-4-yl]-4-(2,4,5-trifluorophenyl)piperidin-3-yl]azanium (PubChem CID 24916926) has the molecular formula C22H22F3N4O2S+ and a molecular weight of 463.51 g/mol. Its IUPAC name is [(3R,4R)-1-[6-(3-methylsulfonylphenyl)pyrimidin-4-yl]-4-(2,4,5-trifluorophenyl)piperidin-3-yl]azanium.
| Compound Name | [(3R,4R)-1-[6-(3-methylsulfonylphenyl)pyrimidin-4-yl]-4-(2,4,5-trifluorophenyl)piperidin-3-yl]azanium |
|---|---|
| PubChem CID | 24916926 |
| Molecular Formula | C22H22F3N4O2S+ |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | [(3R,4R)-1-[6-(3-methylsulfonylphenyl)pyrimidin-4-yl]-4-(2,4,5-trifluorophenyl)piperidin-3-yl]azanium |
| SMILES | CS(=O)(=O)c1cccc(-c2cc(N3CC[C@H](c4cc(F)c(F)cc4F)[C@@H]([NH3+])C3)ncn2)c1 |
| InChI | InChI=1S/C22H21F3N4O2S/c1-32(30,31)14-4-2-3-13(7-14)21-10-22(28-12-27-21)29-6-5-15(20(26)11-29)16-8-18(24)19(25)9-17(16)23/h2-4,7-10,12,15,20H,5-6,11,26H2,1H3/p+1/t15-,20+/m1/s1 |
| InChIKey | GOBIXGZJSMAOFV-QRWLVFNGSA-O |
| XLogP | 2.57 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|