About (3R)-4,4-difluoro-3-(4-methoxyphenyl)sulfonylbutanoate
(3R)-4,4-difluoro-3-(4-methoxyphenyl)sulfonylbutanoate (PubChem CID 24916934) has the molecular formula C11H11F2O5S-
and a molecular weight of 293.27 g/mol. Its IUPAC name is (3R)-4,4-difluoro-3-(4-methoxyphenyl)sulfonylbutanoate.
Molecular Properties
| Compound Name | (3R)-4,4-difluoro-3-(4-methoxyphenyl)sulfonylbutanoate |
| PubChem CID | 24916934 |
| Molecular Formula | C11H11F2O5S- |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | (3R)-4,4-difluoro-3-(4-methoxyphenyl)sulfonylbutanoate |
| SMILES | COc1ccc(S(=O)(=O)[C@H](CC(=O)[O-])C(F)F)cc1 |
| InChI | InChI=1S/C11H12F2O5S/c1-18-7-2-4-8(5-3-7)19(16,17)9(11(12)13)6-10(14)15/h2-5,9,11H,6H2,1H3,(H,14,15)/p-1/t9-/m1/s1 |
| InChIKey | OBQLOVWIRUXBAW-SECBINFHSA-M |
| XLogP | 0.24 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R)-4,4-difluoro-3-(4-methoxyphenyl)sulfonylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4,4-difluoro-3-(4-methoxyphenyl)sulfonylbutanoate?
The IUPAC name of (3R)-4,4-difluoro-3-(4-methoxyphenyl)sulfonylbutanoate (CID 24916934) is (3R)-4,4-difluoro-3-(4-methoxyphenyl)sulfonylbutanoate.
What is the SMILES notation for (3R)-4,4-difluoro-3-(4-methoxyphenyl)sulfonylbutanoate?
The canonical SMILES for (3R)-4,4-difluoro-3-(4-methoxyphenyl)sulfonylbutanoate is COc1ccc(S(=O)(=O)[C@H](CC(=O)[O-])C(F)F)cc1.
What is the InChIKey of (3R)-4,4-difluoro-3-(4-methoxyphenyl)sulfonylbutanoate?
The InChIKey is OBQLOVWIRUXBAW-SECBINFHSA-M. The full InChI is InChI=1S/C11H12F2O5S/c1-18-7-2-4-8(5-3-7)19(16,17)9(11(12)13)6-10(14)15/h2-5,9,11H,6H2,1H3,(H,14,15)/p-1/t9-/m1/s1.
What are the key properties of (3R)-4,4-difluoro-3-(4-methoxyphenyl)sulfonylbutanoate?
(3R)-4,4-difluoro-3-(4-methoxyphenyl)sulfonylbutanoate has a molecular weight of 293.27 g/mol, XLogP of 0.24, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4,4-difluoro-3-(4-methoxyphenyl)sulfonylbutanoate is sourced from PubChem (CID 24916934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).