C18H21F6N5+2 — CID 24916943
[(1S,2R,5S)-5-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-7-ium-7-yl]-2-(2,4,5-trifluorophenyl)cyclohexyl]azanium (PubChem CID 24916943) has the molecular formula C18H21F6N5+2 and a molecular weight of 421.39 g/mol. Its IUPAC name is [(1S,2R,5S)-5-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-7-ium-7-yl]-2-(2,4,5-trifluorophenyl)cyclohexyl]azanium.
| Compound Name | [(1S,2R,5S)-5-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-7-ium-7-yl]-2-(2,4,5-trifluorophenyl)cyclohexyl]azanium |
|---|---|
| PubChem CID | 24916943 |
| Molecular Formula | C18H21F6N5+2 |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | [(1S,2R,5S)-5-[3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazin-7-ium-7-yl]-2-(2,4,5-trifluorophenyl)cyclohexyl]azanium |
| SMILES | [NH3+][C@H]1C[C@@H]([NH+]2CCn3c(nnc3C(F)(F)F)C2)CCC1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H19F6N5/c19-12-7-14(21)13(20)6-11(12)10-2-1-9(5-15(10)25)28-3-4-29-16(8-28)26-27-17(29)18(22,23)24/h6-7,9-10,15H,1-5,8,25H2/p+2/t9-,10?,15-/m0/s1 |
| InChIKey | CNKRZILQBKJWDS-WGXACRJMSA-P |
| XLogP | 1.06 |
| TPSA | 62.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|