C8H16NO4+ — CID 24916955
(1S,6S,7R,8R,8aR)-2,3,4,5,6,7,8,8a-octahydro-1H-indolizin-4-ium-1,6,7,8-tetrol (PubChem CID 24916955) has the molecular formula C8H16NO4+ and a molecular weight of 190.22 g/mol. Its IUPAC name is (1S,6S,7R,8R,8aR)-2,3,4,5,6,7,8,8a-octahydro-1H-indolizin-4-ium-1,6,7,8-tetrol.
| Compound Name | (1S,6S,7R,8R,8aR)-2,3,4,5,6,7,8,8a-octahydro-1H-indolizin-4-ium-1,6,7,8-tetrol |
|---|---|
| PubChem CID | 24916955 |
| Molecular Formula | C8H16NO4+ |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (1S,6S,7R,8R,8aR)-2,3,4,5,6,7,8,8a-octahydro-1H-indolizin-4-ium-1,6,7,8-tetrol |
| SMILES | O[C@H]1[C@H](O)[C@@H](O)C[NH+]2CC[C@H](O)[C@H]12 |
| InChI | InChI=1S/C8H15NO4/c10-4-1-2-9-3-5(11)7(12)8(13)6(4)9/h4-8,10-13H,1-3H2/p+1/t4-,5-,6+,7+,8+/m0/s1 |
| InChIKey | JDVVGAQPNNXQDW-TVNFTVLESA-O |
| XLogP | -3.90 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |