C22H32FN6O2+ — CID 24916986
[(2S,3S)-4-(dimethylamino)-1-[(3S)-3-fluoropyrrolidin-1-yl]-1,4-dioxo-3-[4-([1,2,4]triazolo[1,5-a]pyridin-5-yl)cyclohexyl]butan-2-yl]azanium (PubChem CID 24916986) has the molecular formula C22H32FN6O2+ and a molecular weight of 431.54 g/mol. Its IUPAC name is [(2S,3S)-4-(dimethylamino)-1-[(3S)-3-fluoropyrrolidin-1-yl]-1,4-dioxo-3-[4-([1,2,4]triazolo[1,5-a]pyridin-5-yl)cyclohexyl]butan-2-yl]azanium.
| Compound Name | [(2S,3S)-4-(dimethylamino)-1-[(3S)-3-fluoropyrrolidin-1-yl]-1,4-dioxo-3-[4-([1,2,4]triazolo[1,5-a]pyridin-5-yl)cyclohexyl]butan-2-yl]azanium |
|---|---|
| PubChem CID | 24916986 |
| Molecular Formula | C22H32FN6O2+ |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | [(2S,3S)-4-(dimethylamino)-1-[(3S)-3-fluoropyrrolidin-1-yl]-1,4-dioxo-3-[4-([1,2,4]triazolo[1,5-a]pyridin-5-yl)cyclohexyl]butan-2-yl]azanium |
| SMILES | CN(C)C(=O)[C@@H](C1CCC(c2cccc3ncnn23)CC1)[C@H]([NH3+])C(=O)N1CC[C@H](F)C1 |
| InChI | InChI=1S/C22H31FN6O2/c1-27(2)21(30)19(20(24)22(31)28-11-10-16(23)12-28)15-8-6-14(7-9-15)17-4-3-5-18-25-13-26-29(17)18/h3-5,13-16,19-20H,6-12,24H2,1-2H3/p+1/t14?,15?,16-,19-,20-/m0/s1 |
| InChIKey | ZPWDKZWKUOYOHA-AJHRRDMJSA-O |
| XLogP | 0.89 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |