C22H31F2N6O2+ — CID 24916987
[(2S,3S)-1-(3,3-difluoropyrrolidin-1-yl)-4-(dimethylamino)-1,4-dioxo-3-[4-([1,2,4]triazolo[1,5-a]pyridin-6-yl)cyclohexyl]butan-2-yl]azanium (PubChem CID 24916987) has the molecular formula C22H31F2N6O2+ and a molecular weight of 449.53 g/mol. Its IUPAC name is [(2S,3S)-1-(3,3-difluoropyrrolidin-1-yl)-4-(dimethylamino)-1,4-dioxo-3-[4-([1,2,4]triazolo[1,5-a]pyridin-6-yl)cyclohexyl]butan-2-yl]azanium.
| Compound Name | [(2S,3S)-1-(3,3-difluoropyrrolidin-1-yl)-4-(dimethylamino)-1,4-dioxo-3-[4-([1,2,4]triazolo[1,5-a]pyridin-6-yl)cyclohexyl]butan-2-yl]azanium |
|---|---|
| PubChem CID | 24916987 |
| Molecular Formula | C22H31F2N6O2+ |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | [(2S,3S)-1-(3,3-difluoropyrrolidin-1-yl)-4-(dimethylamino)-1,4-dioxo-3-[4-([1,2,4]triazolo[1,5-a]pyridin-6-yl)cyclohexyl]butan-2-yl]azanium |
| SMILES | CN(C)C(=O)[C@@H](C1CCC(c2ccc3ncnn3c2)CC1)[C@H]([NH3+])C(=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C22H30F2N6O2/c1-28(2)20(31)18(19(25)21(32)29-10-9-22(23,24)12-29)15-5-3-14(4-6-15)16-7-8-17-26-13-27-30(17)11-16/h7-8,11,13-15,18-19H,3-6,9-10,12,25H2,1-2H3/p+1/t14?,15?,18-,19-/m0/s1 |
| InChIKey | JNAZOMVWUGPITI-BURPLHJFSA-O |
| XLogP | 1.19 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |