C27H48N3O5+ — CID 24917006
[(2R,4S,5S,7S)-1-(butylamino)-4-hydroxy-7-[[[2-(3-methoxypropoxy)benzoyl]amino]methyl]-2,8-dimethyl-1-oxononan-5-yl]azanium (PubChem CID 24917006) has the molecular formula C27H48N3O5+ and a molecular weight of 494.70 g/mol. Its IUPAC name is [(2R,4S,5S,7S)-1-(butylamino)-4-hydroxy-7-[[[2-(3-methoxypropoxy)benzoyl]amino]methyl]-2,8-dimethyl-1-oxononan-5-yl]azanium.
| Compound Name | [(2R,4S,5S,7S)-1-(butylamino)-4-hydroxy-7-[[[2-(3-methoxypropoxy)benzoyl]amino]methyl]-2,8-dimethyl-1-oxononan-5-yl]azanium |
|---|---|
| PubChem CID | 24917006 |
| Molecular Formula | C27H48N3O5+ |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | [(2R,4S,5S,7S)-1-(butylamino)-4-hydroxy-7-[[[2-(3-methoxypropoxy)benzoyl]amino]methyl]-2,8-dimethyl-1-oxononan-5-yl]azanium |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H]([NH3+])C[C@H](CNC(=O)c1ccccc1OCCCOC)C(C)C |
| InChI | InChI=1S/C27H47N3O5/c1-6-7-13-29-26(32)20(4)16-24(31)23(28)17-21(19(2)3)18-30-27(33)22-11-8-9-12-25(22)35-15-10-14-34-5/h8-9,11-12,19-21,23-24,31H,6-7,10,13-18,28H2,1-5H3,(H,29,32)(H,30,33)/p+1/t20-,21-,23+,24+/m1/s1 |
| InChIKey | JYPXLSXKONMTFW-HTDNTCHWSA-O |
| XLogP | 2.41 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|