About Azaribin
Azaribin (PubChem CID 249187) has the molecular formula C14H17N3O9
and a molecular weight of 371.30 g/mol. Its IUPAC name is [3,4-diacetyloxy-5-(3,5-dioxo-1,2,4-triazin-2-yl)oxolan-2-yl]methyl acetate.
Molecular Properties
| Compound Name | Azaribin |
| PubChem CID | 249187 |
| Molecular Formula | C14H17N3O9 |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | [3,4-diacetyloxy-5-(3,5-dioxo-1,2,4-triazin-2-yl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1C(C(C(O1)N2C(=O)NC(=O)C=N2)OC(=O)C)OC(=O)C |
| InChI | InChI=1S/C14H17N3O9/c1-6(18)23-5-9-11(24-7(2)19)12(25-8(3)20)13(26-9)17-14(22)16-10(21)4-15-17/h4,9,11-13H,5H2,1-3H3,(H,16,21,22) |
| InChIKey | QQOBRRFOVWGIMD-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | 662 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze Azaribin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Azaribin?
The IUPAC name of Azaribin (CID 249187) is [3,4-diacetyloxy-5-(3,5-dioxo-1,2,4-triazin-2-yl)oxolan-2-yl]methyl acetate.
What is the SMILES notation for Azaribin?
The canonical SMILES for Azaribin is CC(=O)OCC1C(C(C(O1)N2C(=O)NC(=O)C=N2)OC(=O)C)OC(=O)C.
What is the InChIKey of Azaribin?
The InChIKey is QQOBRRFOVWGIMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O9/c1-6(18)23-5-9-11(24-7(2)19)12(25-8(3)20)13(26-9)17-14(22)16-10(21)4-15-17/h4,9,11-13H,5H2,1-3H3,(H,16,21,22).
What are the key properties of Azaribin?
Azaribin has a molecular weight of 371.30 g/mol, XLogP of -0.20, 8 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for Azaribin is sourced from PubChem (CID 249187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).