C17H17N3O2S — CID 24918911
6-(2H-chromen-3-ylmethyl)-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 24918911) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 6-(2H-chromen-3-ylmethyl)-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-(2H-chromen-3-ylmethyl)-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24918911 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 6-(2H-chromen-3-ylmethyl)-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2c1CN(CC1=Cc3ccccc3OC1)CC2 |
| InChI | InChI=1S/C17H17N3O2S/c21-16-13-9-20(6-5-14(13)18-17(23)19-16)8-11-7-12-3-1-2-4-15(12)22-10-11/h1-4,7H,5-6,8-10H2,(H2,18,19,21,23) |
| InChIKey | WZUUHYAZKVJUIA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 61.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|