C17H13BrClN3O3S — CID 24920107
6-[(6-bromo-4-chloro-2-oxochromen-3-yl)methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 24920107) has the molecular formula C17H13BrClN3O3S and a molecular weight of 454.73 g/mol. Its IUPAC name is 6-[(6-bromo-4-chloro-2-oxochromen-3-yl)methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(6-bromo-4-chloro-2-oxochromen-3-yl)methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24920107 |
| Molecular Formula | C17H13BrClN3O3S |
| Molecular Weight | 454.73 g/mol |
| Exact Mass | 452.95 |
| IUPAC Name | 6-[(6-bromo-4-chloro-2-oxochromen-3-yl)methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2c1CN(Cc1c(Cl)c3cc(Br)ccc3oc1=O)CC2 |
| InChI | InChI=1S/C17H13BrClN3O3S/c18-8-1-2-13-9(5-8)14(19)11(16(24)25-13)7-22-4-3-12-10(6-22)15(23)21-17(26)20-12/h1-2,5H,3-4,6-7H2,(H2,20,21,23,26) |
| InChIKey | PZQGXBIUIWJKHV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 82.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.73 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|